C16H24N2OS2 — CID 106586947
2-ethylsulfanyl-6-[3-(methoxymethyl)piperidin-1-yl]benzenecarbothioamide (PubChem CID 106586947) has the molecular formula C16H24N2OS2 and a molecular weight of 324.52 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[3-(methoxymethyl)piperidin-1-yl]benzenecarbothioamide.
| Compound Name | 2-ethylsulfanyl-6-[3-(methoxymethyl)piperidin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106586947 |
| Molecular Formula | C16H24N2OS2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-ethylsulfanyl-6-[3-(methoxymethyl)piperidin-1-yl]benzenecarbothioamide |
| SMILES | CCSc1cccc(N2CCCC(COC)C2)c1C(N)=S |
| InChI | InChI=1S/C16H24N2OS2/c1-3-21-14-8-4-7-13(15(14)16(17)20)18-9-5-6-12(10-18)11-19-2/h4,7-8,12H,3,5-6,9-11H2,1-2H3,(H2,17,20) |
| InChIKey | BYICNDBKNWWFIQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|