C14H20N2O2S2 — CID 102932907
2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide (PubChem CID 102932907) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 102932907 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide |
| SMILES | CSc1cccc(N2CC(C)OC(CO)C2)c1C(N)=S |
| InChI | InChI=1S/C14H20N2O2S2/c1-9-6-16(7-10(8-17)18-9)11-4-3-5-12(20-2)13(11)14(15)19/h3-5,9-10,17H,6-8H2,1-2H3,(H2,15,19) |
| InChIKey | LAZMCFOXLPZAEG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|