C15H24N4OS — CID 114538150
N'-hydroxy-2-methylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarboximidamide (PubChem CID 114538150) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is N'-hydroxy-2-methylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 114538150 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N'-hydroxy-2-methylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarboximidamide |
| SMILES | CSc1cccc(N2CC(C)N(C)C(C)C2)c1/C(N)=N/O |
| InChI | InChI=1S/C15H24N4OS/c1-10-8-19(9-11(2)18(10)3)12-6-5-7-13(21-4)14(12)15(16)17-20/h5-7,10-11,20H,8-9H2,1-4H3,(H2,16,17) |
| InChIKey | RDLPQQWFVYTXMW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|