C14H20BrN3S — CID 114882760
2-bromo-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarbothioamide (PubChem CID 114882760) has the molecular formula C14H20BrN3S and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-bromo-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114882760 |
| Molecular Formula | C14H20BrN3S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-bromo-6-(3,4,5-trimethylpiperazin-1-yl)benzenecarbothioamide |
| SMILES | CC1CN(c2cccc(Br)c2C(N)=S)CC(C)N1C |
| InChI | InChI=1S/C14H20BrN3S/c1-9-7-18(8-10(2)17(9)3)12-6-4-5-11(15)13(12)14(16)19/h4-6,9-10H,7-8H2,1-3H3,(H2,16,19) |
| InChIKey | CZZQRJLCZKPRPD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|