C14H19BrN2S — CID 114882310
2-bromo-6-(2,3-dimethylpiperidin-1-yl)benzenecarbothioamide (PubChem CID 114882310) has the molecular formula C14H19BrN2S and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-bromo-6-(2,3-dimethylpiperidin-1-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-6-(2,3-dimethylpiperidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114882310 |
| Molecular Formula | C14H19BrN2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-bromo-6-(2,3-dimethylpiperidin-1-yl)benzenecarbothioamide |
| SMILES | CC1CCCN(c2cccc(Br)c2C(N)=S)C1C |
| InChI | InChI=1S/C14H19BrN2S/c1-9-5-4-8-17(10(9)2)12-7-3-6-11(15)13(12)14(16)18/h3,6-7,9-10H,4-5,8H2,1-2H3,(H2,16,18) |
| InChIKey | HUZRTSHMFNKMFW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|