C15H21BrN4 — CID 114883859
2-bromo-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzenecarboximidamide (PubChem CID 114883859) has the molecular formula C15H21BrN4 and a molecular weight of 337.27 g/mol. Its IUPAC name is 2-bromo-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzenecarboximidamide.
| Compound Name | 2-bromo-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 114883859 |
| Molecular Formula | C15H21BrN4 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-bromo-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Br)cccc1N1CC2CCCN2CC1C |
| InChI | InChI=1S/C15H21BrN4/c1-10-8-19-7-3-4-11(19)9-20(10)13-6-2-5-12(16)14(13)15(17)18/h2,5-6,10-11H,3-4,7-9H2,1H3,(H3,17,18) |
| InChIKey | GCERCTJIJTUNFM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|