C14H18BrFN2 — CID 107640052
2-(2-bromo-5-fluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 107640052) has the molecular formula C14H18BrFN2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 107640052 |
| Molecular Formula | C14H18BrFN2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H18BrFN2/c1-10-8-17-6-2-3-12(17)9-18(10)14-7-11(16)4-5-13(14)15/h4-5,7,10,12H,2-3,6,8-9H2,1H3 |
| InChIKey | QSQWZQGVCCWHNT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |