C15H21BrFN3 — CID 116736108
4-bromo-5-fluoro-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)aniline (PubChem CID 116736108) has the molecular formula C15H21BrFN3 and a molecular weight of 342.26 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)aniline.
| Compound Name | 4-bromo-5-fluoro-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)aniline |
|---|---|
| PubChem CID | 116736108 |
| Molecular Formula | C15H21BrFN3 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-bromo-5-fluoro-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)aniline |
| SMILES | CC1CN2CCCCC2CN1c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C15H21BrFN3/c1-10-8-19-5-3-2-4-11(19)9-20(10)15-6-12(16)13(17)7-14(15)18/h6-7,10-11H,2-5,8-9,18H2,1H3 |
| InChIKey | XDUBHGUAHLMSOR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|