C17H25FN2O — CID 79921453
(1S)-1-[3-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)phenyl]ethanol (PubChem CID 79921453) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[3-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 79921453 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (1S)-1-[3-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)phenyl]ethanol |
| SMILES | CC1CN2CCCCC2CN1c1ccc([C@H](C)O)cc1F |
| InChI | InChI=1S/C17H25FN2O/c1-12-10-19-8-4-3-5-15(19)11-20(12)17-7-6-14(13(2)21)9-16(17)18/h6-7,9,12-13,15,21H,3-5,8,10-11H2,1-2H3/t12?,13-,15?/m0/s1 |
| InChIKey | PJMAYGUJGJHMGB-OWYJLGKBSA-N |
| XLogP | 2.94 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|