C17H24N2O2 — CID 79918833
3-methyl-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzoic acid (PubChem CID 79918833) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-methyl-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzoic acid.
| Compound Name | 3-methyl-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 79918833 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-methyl-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1N1CC2CCCCN2CC1C |
| InChI | InChI=1S/C17H24N2O2/c1-12-9-14(17(20)21)6-7-16(12)19-11-15-5-3-4-8-18(15)10-13(19)2/h6-7,9,13,15H,3-5,8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | IQTBSJCEBMIRJX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |