C15H18BrN3 — CID 82797101
3-bromo-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzonitrile (PubChem CID 82797101) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-bromo-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzonitrile.
| Compound Name | 3-bromo-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 82797101 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-bromo-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)benzonitrile |
| SMILES | CC1CN2CCCC2CN1c1ccc(C#N)cc1Br |
| InChI | InChI=1S/C15H18BrN3/c1-11-9-18-6-2-3-13(18)10-19(11)15-5-4-12(8-17)7-14(15)16/h4-5,7,11,13H,2-3,6,9-10H2,1H3 |
| InChIKey | XBSQGNWXZLPACZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |