C10H11BrN2S — CID 130547148
2-(azetidin-1-yl)-6-bromobenzenecarbothioamide (PubChem CID 130547148) has the molecular formula C10H11BrN2S and a molecular weight of 271.18 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-6-bromobenzenecarbothioamide.
| Compound Name | 2-(azetidin-1-yl)-6-bromobenzenecarbothioamide |
|---|---|
| PubChem CID | 130547148 |
| Molecular Formula | C10H11BrN2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 2-(azetidin-1-yl)-6-bromobenzenecarbothioamide |
| SMILES | NC(=S)c1c(Br)cccc1N1CCC1 |
| InChI | InChI=1S/C10H11BrN2S/c11-7-3-1-4-8(9(7)10(12)14)13-5-2-6-13/h1,3-4H,2,5-6H2,(H2,12,14) |
| InChIKey | UAWSTWYCBMUMFM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|