C11H17N3O2 — CID 102932034
[4-(2-amino-3-pyridinyl)-6-methylmorpholin-2-yl]methanol (PubChem CID 102932034) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is [4-(2-amino-3-pyridinyl)-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(2-amino-3-pyridinyl)-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102932034 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | [4-(2-amino-3-pyridinyl)-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(c2cccnc2N)CC(CO)O1 |
| InChI | InChI=1S/C11H17N3O2/c1-8-5-14(6-9(7-15)16-8)10-3-2-4-13-11(10)12/h2-4,8-9,15H,5-7H2,1H3,(H2,12,13) |
| InChIKey | LJGJANBSCFPNTB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |