C14H20N2O4 — CID 102931988
[4-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylmorpholin-2-yl]methanol (PubChem CID 102931988) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [4-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102931988 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [4-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(c2cc3c(cc2N)OCCO3)CC(CO)O1 |
| InChI | InChI=1S/C14H20N2O4/c1-9-6-16(7-10(8-17)20-9)12-5-14-13(4-11(12)15)18-2-3-19-14/h4-5,9-10,17H,2-3,6-8,15H2,1H3 |
| InChIKey | JFVPXNWGHSVOOF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|