C13H16F2N2O2S — CID 107935325
2,3-difluoro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]benzenecarbothioamide (PubChem CID 107935325) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2,3-difluoro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107935325 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2,3-difluoro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]benzenecarbothioamide |
| SMILES | CC1CN(c2ccc(C(N)=S)c(F)c2F)CC(CO)O1 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-7-4-17(5-8(6-18)19-7)10-3-2-9(13(16)20)11(14)12(10)15/h2-3,7-8,18H,4-6H2,1H3,(H2,16,20) |
| InChIKey | SQLXGZNAKCQXJN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|