C12H19BrN2OS — CID 114781000
6-(bromomethyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-dimethylmorpholine (PubChem CID 114781000) has the molecular formula C12H19BrN2OS and a molecular weight of 319.27 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781000 |
| Molecular Formula | C12H19BrN2OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 6-(bromomethyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-dimethylmorpholine |
| SMILES | Cc1nc(N2CC(CBr)OC(C)(C)C2)sc1C |
| InChI | InChI=1S/C12H19BrN2OS/c1-8-9(2)17-11(14-8)15-6-10(5-13)16-12(3,4)7-15/h10H,5-7H2,1-4H3 |
| InChIKey | CBVDNAAKMQXYSY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|