C10H13BrF3N3OS — CID 107306197
6-(bromomethyl)-2,2-dimethyl-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]morpholine (PubChem CID 107306197) has the molecular formula C10H13BrF3N3OS and a molecular weight of 360.20 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 107306197 |
| Molecular Formula | C10H13BrF3N3OS |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]morpholine |
| SMILES | CC1(C)CN(c2nc(C(F)(F)F)ns2)CC(CBr)O1 |
| InChI | InChI=1S/C10H13BrF3N3OS/c1-9(2)5-17(4-6(3-11)18-9)8-15-7(16-19-8)10(12,13)14/h6H,3-5H2,1-2H3 |
| InChIKey | WSWJRAYWLSZDBB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|