C12H19N3S — CID 121185466
4,5-dimethyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-thiazole (PubChem CID 121185466) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 121185466 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4,5-dimethyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-thiazole |
| SMILES | Cc1nc(N2CC3CN(C)CC3C2)sc1C |
| InChI | InChI=1S/C12H19N3S/c1-8-9(2)16-12(13-8)15-6-10-4-14(3)5-11(10)7-15/h10-11H,4-7H2,1-3H3 |
| InChIKey | NXVGYDWNGRLMDS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |