C13H19N3OS — CID 138387409
(3aR,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 138387409) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is (3aR,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 138387409 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (3aR,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1nc(N2C[C@H]3CCN(C)C(=O)[C@H]3C2)sc1C |
| InChI | InChI=1S/C13H19N3OS/c1-8-9(2)18-13(14-8)16-6-10-4-5-15(3)12(17)11(10)7-16/h10-11H,4-7H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | DDYHAVJIQRUOFT-MNOVXSKESA-N |
| XLogP | 1.67 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |