C9H11F2N3 — CID 122269420
2-(3,3-difluoroazetidin-1-yl)-4,6-dimethylpyrimidine (PubChem CID 122269420) has the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(3,3-difluoroazetidin-1-yl)-4,6-dimethylpyrimidine.
| Compound Name | 2-(3,3-difluoroazetidin-1-yl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 122269420 |
| Molecular Formula | C9H11F2N3 |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-(3,3-difluoroazetidin-1-yl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(N2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C9H11F2N3/c1-6-3-7(2)13-8(12-6)14-4-9(10,11)5-14/h3H,4-5H2,1-2H3 |
| InChIKey | HPKSZFRJDXLWOR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |