C11H12F2N4 — CID 177282932
2-(4,4-difluoropiperidin-1-yl)-4-isocyano-6-methylpyrimidine (PubChem CID 177282932) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-4-isocyano-6-methylpyrimidine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-4-isocyano-6-methylpyrimidine |
|---|---|
| PubChem CID | 177282932 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-4-isocyano-6-methylpyrimidine |
| SMILES | [C-]#[N+]c1cc(C)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C11H12F2N4/c1-8-7-9(14-2)16-10(15-8)17-5-3-11(12,13)4-6-17/h7H,3-6H2,1H3 |
| InChIKey | FFZHEXKGPUNFCG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 33.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|