C17H21ClN2 — CID 63445345
2-(chloromethyl)-4-(2-ethylpiperidin-1-yl)quinoline (PubChem CID 63445345) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(2-ethylpiperidin-1-yl)quinoline.
| Compound Name | 2-(chloromethyl)-4-(2-ethylpiperidin-1-yl)quinoline |
|---|---|
| PubChem CID | 63445345 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-(chloromethyl)-4-(2-ethylpiperidin-1-yl)quinoline |
| SMILES | CCC1CCCCN1c1cc(CCl)nc2ccccc12 |
| InChI | InChI=1S/C17H21ClN2/c1-2-14-7-5-6-10-20(14)17-11-13(12-18)19-16-9-4-3-8-15(16)17/h3-4,8-9,11,14H,2,5-7,10,12H2,1H3 |
| InChIKey | WKOMMCHYYNGOAK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|