C14H18ClNO2 — CID 114844209
4-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzaldehyde (PubChem CID 114844209) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzaldehyde.
| Compound Name | 4-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 114844209 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzaldehyde |
| SMILES | CC1CN(c2cc(Cl)ccc2C=O)CC(C)(C)O1 |
| InChI | InChI=1S/C14H18ClNO2/c1-10-7-16(9-14(2,3)18-10)13-6-12(15)5-4-11(13)8-17/h4-6,8,10H,7,9H2,1-3H3 |
| InChIKey | PULIRSHOZRBXCG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|