C17H27ClN2O — CID 114861313
1-[5-chloro-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]butan-2-amine (PubChem CID 114861313) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-[5-chloro-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]butan-2-amine.
| Compound Name | 1-[5-chloro-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 114861313 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[5-chloro-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Cl)ccc1N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C17H27ClN2O/c1-5-15(19)9-13-8-14(18)6-7-16(13)20-10-12(2)21-17(3,4)11-20/h6-8,12,15H,5,9-11,19H2,1-4H3 |
| InChIKey | MGVTXJPAXCSOKN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |