C16H25BrN2O — CID 63817747
1-[4-bromo-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]propan-2-amine (PubChem CID 63817747) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-[4-bromo-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]propan-2-amine.
| Compound Name | 1-[4-bromo-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 63817747 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[4-bromo-2-(2,2,6-trimethylmorpholin-4-yl)phenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(Br)cc1N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H25BrN2O/c1-11(18)7-13-5-6-14(17)8-15(13)19-9-12(2)20-16(3,4)10-19/h5-6,8,11-12H,7,9-10,18H2,1-4H3 |
| InChIKey | SKFKCZAKIWQGCI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |