C20H20ClN3O — CID 23828257
4-[2-(2-chlorophenyl)quinazolin-4-yl]-2,6-dimethylmorpholine (PubChem CID 23828257) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)quinazolin-4-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[2-(2-chlorophenyl)quinazolin-4-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 23828257 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[2-(2-chlorophenyl)quinazolin-4-yl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2nc(-c3ccccc3Cl)nc3ccccc23)CC(C)O1 |
| InChI | InChI=1S/C20H20ClN3O/c1-13-11-24(12-14(2)25-13)20-16-8-4-6-10-18(16)22-19(23-20)15-7-3-5-9-17(15)21/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | UKVNYLUHVZTAFK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |