C20H19Cl2N3 — CID 23740947
2-(2,4-dichlorophenyl)-4-(3-methylpiperidin-1-yl)quinazoline (PubChem CID 23740947) has the molecular formula C20H19Cl2N3 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-(3-methylpiperidin-1-yl)quinazoline.
| Compound Name | 2-(2,4-dichlorophenyl)-4-(3-methylpiperidin-1-yl)quinazoline |
|---|---|
| PubChem CID | 23740947 |
| Molecular Formula | C20H19Cl2N3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-(3-methylpiperidin-1-yl)quinazoline |
| SMILES | CC1CCCN(c2nc(-c3ccc(Cl)cc3Cl)nc3ccccc23)C1 |
| InChI | InChI=1S/C20H19Cl2N3/c1-13-5-4-10-25(12-13)20-16-6-2-3-7-18(16)23-19(24-20)15-9-8-14(21)11-17(15)22/h2-3,6-9,11,13H,4-5,10,12H2,1H3 |
| InChIKey | QPFWDXRDNTYFEU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |