C14H18N4O — CID 102987519
3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-amine (PubChem CID 102987519) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-amine.
| Compound Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 102987519 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-amine |
| SMILES | C[C@@H]1CN(c2nc3ccccc3nc2N)C[C@H](C)O1 |
| InChI | InChI=1S/C14H18N4O/c1-9-7-18(8-10(2)19-9)14-13(15)16-11-5-3-4-6-12(11)17-14/h3-6,9-10H,7-8H2,1-2H3,(H2,15,16)/t9-,10+ |
| InChIKey | ZTRVOXWTTSIZOI-AOOOYVTPSA-N |
| XLogP | 1.83 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |