C18H24N4O3 — CID 122058685
4-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]butanoic acid (PubChem CID 122058685) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 122058685 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]butanoic acid |
| SMILES | CC1CN(c2nc3ccccc3nc2NCCCC(=O)O)CC(C)O1 |
| InChI | InChI=1S/C18H24N4O3/c1-12-10-22(11-13(2)25-12)18-17(19-9-5-8-16(23)24)20-14-6-3-4-7-15(14)21-18/h3-4,6-7,12-13H,5,8-11H2,1-2H3,(H,19,20)(H,23,24) |
| InChIKey | DQCQRWWDGMXPLF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|