C19H25N7O2 — CID 137248421
3-[3-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137248421) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 3-[3-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[3-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137248421 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[3-[[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC1CN(c2nc3ccccc3nc2NCCCc2n[nH]c(=O)[nH]2)CC(C)O1 |
| InChI | InChI=1S/C19H25N7O2/c1-12-10-26(11-13(2)28-12)18-17(21-14-6-3-4-7-15(14)22-18)20-9-5-8-16-23-19(27)25-24-16/h3-4,6-7,12-13H,5,8-11H2,1-2H3,(H,20,21)(H2,23,24,25,27) |
| InChIKey | LBZDVLSHYZXSGE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|