C14H18N4O2 — CID 103541708
3-(3,4-dimethoxypyrrolidin-1-yl)quinoxalin-2-amine (PubChem CID 103541708) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(3,4-dimethoxypyrrolidin-1-yl)quinoxalin-2-amine.
| Compound Name | 3-(3,4-dimethoxypyrrolidin-1-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 103541708 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(3,4-dimethoxypyrrolidin-1-yl)quinoxalin-2-amine |
| SMILES | COC1CN(c2nc3ccccc3nc2N)CC1OC |
| InChI | InChI=1S/C14H18N4O2/c1-19-11-7-18(8-12(11)20-2)14-13(15)16-9-5-3-4-6-10(9)17-14/h3-6,11-12H,7-8H2,1-2H3,(H2,15,16) |
| InChIKey | RFVIJHXDXCEQMR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |