C11H17N3O2 — CID 103530537
2-(3,4-dimethoxypyrrolidin-1-yl)pyridin-3-amine (PubChem CID 103530537) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)pyridin-3-amine.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 103530537 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)pyridin-3-amine |
| SMILES | COC1CN(c2ncccc2N)CC1OC |
| InChI | InChI=1S/C11H17N3O2/c1-15-9-6-14(7-10(9)16-2)11-8(12)4-3-5-13-11/h3-5,9-10H,6-7,12H2,1-2H3 |
| InChIKey | DOQVBFXRCXORON-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |