C10H15N3O2 — CID 129359554
(3R,4R)-1-(3-amino-2-pyridinyl)-4-methoxypyrrolidin-3-ol (PubChem CID 129359554) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (3R,4R)-1-(3-amino-2-pyridinyl)-4-methoxypyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-(3-amino-2-pyridinyl)-4-methoxypyrrolidin-3-ol |
|---|---|
| PubChem CID | 129359554 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3R,4R)-1-(3-amino-2-pyridinyl)-4-methoxypyrrolidin-3-ol |
| SMILES | CO[C@@H]1CN(c2ncccc2N)C[C@H]1O |
| InChI | InChI=1S/C10H15N3O2/c1-15-9-6-13(5-8(9)14)10-7(11)3-2-4-12-10/h2-4,8-9,14H,5-6,11H2,1H3/t8-,9-/m1/s1 |
| InChIKey | HGQFEAFLPSPHTJ-RKDXNWHRSA-N |
| XLogP | -0.14 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |