C11H17N3O — CID 129445700
(3R,4R)-1-(3-amino-2-pyridinyl)-3-methylpiperidin-4-ol (PubChem CID 129445700) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (3R,4R)-1-(3-amino-2-pyridinyl)-3-methylpiperidin-4-ol.
| Compound Name | (3R,4R)-1-(3-amino-2-pyridinyl)-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 129445700 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3R,4R)-1-(3-amino-2-pyridinyl)-3-methylpiperidin-4-ol |
| SMILES | C[C@@H]1CN(c2ncccc2N)CC[C@H]1O |
| InChI | InChI=1S/C11H17N3O/c1-8-7-14(6-4-10(8)15)11-9(12)3-2-5-13-11/h2-3,5,8,10,15H,4,6-7,12H2,1H3/t8-,10-/m1/s1 |
| InChIKey | RUIVLAVDIMPIAF-PSASIEDQSA-N |
| XLogP | 0.87 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |