C12H19N3 — CID 28845965
2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyridin-3-amine (PubChem CID 28845965) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyridin-3-amine.
| Compound Name | 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 28845965 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyridin-3-amine |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ncccc2N)C1 |
| InChI | InChI=1S/C12H19N3/c1-9-6-10(2)8-15(7-9)12-11(13)4-3-5-14-12/h3-5,9-10H,6-8,13H2,1-2H3/t9-,10+ |
| InChIKey | CWNKGXSVOUKHTA-AOOOYVTPSA-N |
| XLogP | 2.15 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |