C11H15N3O — CID 66391110
2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridin-3-amine (PubChem CID 66391110) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridin-3-amine.
| Compound Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 66391110 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridin-3-amine |
| SMILES | Nc1cccnc1N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C11H15N3O/c12-10-2-1-5-13-11(10)14-6-8-3-4-9(7-14)15-8/h1-2,5,8-9H,3-4,6-7,12H2 |
| InChIKey | YHUFWGXZWZKVQD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |