C10H15N3O3 — CID 106667349
1-(3-amino-6-methoxy-2-pyridinyl)pyrrolidine-3,4-diol (PubChem CID 106667349) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-(3-amino-6-methoxy-2-pyridinyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(3-amino-6-methoxy-2-pyridinyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667349 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-(3-amino-6-methoxy-2-pyridinyl)pyrrolidine-3,4-diol |
| SMILES | COc1ccc(N)c(N2CC(O)C(O)C2)n1 |
| InChI | InChI=1S/C10H15N3O3/c1-16-9-3-2-6(11)10(12-9)13-4-7(14)8(15)5-13/h2-3,7-8,14-15H,4-5,11H2,1H3 |
| InChIKey | AIHPXIHHTSCLAZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |