C11H18N4 — CID 28744763
2-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine (PubChem CID 28744763) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine.
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 28744763 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine |
| SMILES | CN1CCCN(c2ncccc2N)CC1 |
| InChI | InChI=1S/C11H18N4/c1-14-6-3-7-15(9-8-14)11-10(12)4-2-5-13-11/h2,4-5H,3,6-9,12H2,1H3 |
| InChIKey | DJZUYSBACQACHE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |