C10H18Cl2N4 — CID 122160375
1-methyl-4-pyrimidin-2-yl-1,4-diazepane;dihydrochloride (PubChem CID 122160375) has the molecular formula C10H18Cl2N4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 1-methyl-4-pyrimidin-2-yl-1,4-diazepane;dihydrochloride.
| Compound Name | 1-methyl-4-pyrimidin-2-yl-1,4-diazepane;dihydrochloride |
|---|---|
| PubChem CID | 122160375 |
| Molecular Formula | C10H18Cl2N4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-methyl-4-pyrimidin-2-yl-1,4-diazepane;dihydrochloride |
| SMILES | CN1CCCN(c2ncccn2)CC1.Cl.Cl |
| InChI | InChI=1S/C10H16N4.2ClH/c1-13-6-3-7-14(9-8-13)10-11-4-2-5-12-10;;/h2,4-5H,3,6-9H2,1H3;2*1H |
| InChIKey | MSGIXXCQWKATNY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |