C10H16N4O2S — CID 30397162
1-methylsulfonyl-4-pyrimidin-2-yl-1,4-diazepane (PubChem CID 30397162) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-methylsulfonyl-4-pyrimidin-2-yl-1,4-diazepane.
| Compound Name | 1-methylsulfonyl-4-pyrimidin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 30397162 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-methylsulfonyl-4-pyrimidin-2-yl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C10H16N4O2S/c1-17(15,16)14-7-3-6-13(8-9-14)10-11-4-2-5-12-10/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | QHXBRMVIDIRHMQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |