C12H19N3O2S — CID 51346045
1-(3-methyl-2-pyridinyl)-4-methylsulfonyl-1,4-diazepane (PubChem CID 51346045) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(3-methyl-2-pyridinyl)-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 51346045 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-4-methylsulfonyl-1,4-diazepane |
| SMILES | Cc1cccnc1N1CCCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H19N3O2S/c1-11-5-3-6-13-12(11)14-7-4-8-15(10-9-14)18(2,16)17/h3,5-6H,4,7-10H2,1-2H3 |
| InChIKey | MQTLAKONHIHBRA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |