C13H17N5O2S — CID 165433317
4-(4-methylsulfonyl-1,4-diazepan-1-yl)pyrido[3,4-d]pyrimidine (PubChem CID 165433317) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-(4-methylsulfonyl-1,4-diazepan-1-yl)pyrido[3,4-d]pyrimidine.
| Compound Name | 4-(4-methylsulfonyl-1,4-diazepan-1-yl)pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 165433317 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-(4-methylsulfonyl-1,4-diazepan-1-yl)pyrido[3,4-d]pyrimidine |
| SMILES | CS(=O)(=O)N1CCCN(c2ncnc3cnccc23)CC1 |
| InChI | InChI=1S/C13H17N5O2S/c1-21(19,20)18-6-2-5-17(7-8-18)13-11-3-4-14-9-12(11)15-10-16-13/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | JQNURUROYHMEQB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |