About 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one
4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one (PubChem CID 171326741) has the molecular formula C11H11N5O
and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one |
| PubChem CID | 171326741 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one |
| SMILES | O=C1CN(c2ncnc3cnccc23)CCN1 |
| InChI | InChI=1S/C11H11N5O/c17-10-6-16(4-3-13-10)11-8-1-2-12-5-9(8)14-7-15-11/h1-2,5,7H,3-4,6H2,(H,13,17) |
| InChIKey | MTGMOBAEJLQMFX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one?
The IUPAC name of 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one (CID 171326741) is 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one.
What is the SMILES notation for 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one?
The canonical SMILES for 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one is O=C1CN(c2ncnc3cnccc23)CCN1.
What is the InChIKey of 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one?
The InChIKey is MTGMOBAEJLQMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O/c17-10-6-16(4-3-13-10)11-8-1-2-12-5-9(8)14-7-15-11/h1-2,5,7H,3-4,6H2,(H,13,17).
What are the key properties of 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one?
4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one has a molecular weight of 229.24 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-2-one is sourced from PubChem (CID 171326741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).