C18H16N6S — CID 155975559
2-(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 155975559) has the molecular formula C18H16N6S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155975559 |
| Molecular Formula | C18H16N6S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(N3CCN(c4ncnc5cnccc45)CC3)nc2c1 |
| InChI | InChI=1S/C18H16N6S/c1-2-4-16-14(3-1)22-18(25-16)24-9-7-23(8-10-24)17-13-5-6-19-11-15(13)20-12-21-17/h1-6,11-12H,7-10H2 |
| InChIKey | SUPLCYJJICJPFQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |