C17H16N4OS — CID 121082962
[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-pyridin-2-ylmethanone (PubChem CID 121082962) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 121082962 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H16N4OS/c22-16(14-6-3-4-8-18-14)20-9-11-21(12-10-20)17-19-13-5-1-2-7-15(13)23-17/h1-8H,9-12H2 |
| InChIKey | HOMDGWDSZMMSBT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |