C13H16N4OS — CID 24760998
2-amino-1-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 24760998) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-amino-1-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24760998 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-amino-1-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C13H16N4OS/c14-9-12(18)16-5-7-17(8-6-16)13-15-10-3-1-2-4-11(10)19-13/h1-4H,5-9,14H2 |
| InChIKey | YLEOZRJQIHYJCW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |