C17H19N5S — CID 133391255
4,5-dimethyl-2-(4-quinazolin-4-ylpiperazin-1-yl)-1,3-thiazole (PubChem CID 133391255) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 4,5-dimethyl-2-(4-quinazolin-4-ylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(4-quinazolin-4-ylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 133391255 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4,5-dimethyl-2-(4-quinazolin-4-ylpiperazin-1-yl)-1,3-thiazole |
| SMILES | Cc1nc(N2CCN(c3ncnc4ccccc34)CC2)sc1C |
| InChI | InChI=1S/C17H19N5S/c1-12-13(2)23-17(20-12)22-9-7-21(8-10-22)16-14-5-3-4-6-15(14)18-11-19-16/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | KUVCKPCUZRJLLH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |