C14H18N4S — CID 171335410
4,5-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole (PubChem CID 171335410) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 4,5-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 171335410 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4,5-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole |
| SMILES | Cc1nc(N2CCN(c3ccccn3)CC2)sc1C |
| InChI | InChI=1S/C14H18N4S/c1-11-12(2)19-14(16-11)18-9-7-17(8-10-18)13-5-3-4-6-15-13/h3-6H,7-10H2,1-2H3 |
| InChIKey | XXTXYXVFNWJYIR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |