C18H20N4S — CID 121083589
4,6-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 121083589) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4,6-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole.
| Compound Name | 4,6-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 121083589 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4,6-dimethyl-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | Cc1cc(C)c2nc(N3CCN(c4ccccn4)CC3)sc2c1 |
| InChI | InChI=1S/C18H20N4S/c1-13-11-14(2)17-15(12-13)23-18(20-17)22-9-7-21(8-10-22)16-5-3-4-6-19-16/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | YDMHBQSLNUKYRI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |