C18H18F2N6 — CID 154882816
4-[4-[6-(difluoromethyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]quinazoline (PubChem CID 154882816) has the molecular formula C18H18F2N6 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[4-[6-(difluoromethyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]quinazoline.
| Compound Name | 4-[4-[6-(difluoromethyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 154882816 |
| Molecular Formula | C18H18F2N6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[4-[6-(difluoromethyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]quinazoline |
| SMILES | Cc1nc(C(F)F)cc(N2CCN(c3ncnc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C18H18F2N6/c1-12-23-15(17(19)20)10-16(24-12)25-6-8-26(9-7-25)18-13-4-2-3-5-14(13)21-11-22-18/h2-5,10-11,17H,6-9H2,1H3 |
| InChIKey | PXGPLZZOYDBFDU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |